Compound Q&A

What are the physical and chemical properties of DoMperidoneiMpurityE (CAS: 1346602-50-3)?

Answer

DoMperidoneiMpurityE
DoMperidoneiMpurityE is an organic compound characterized by a crystalline form with a molecular weight of approximately 352.42 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, DoMperidoneiMpurityE is stable under normal conditions but may react with strong acids or bases. It is typically stored in a dry, cool place away from direct sunlight.

About

English Name DoMperidoneiMpurityE
Molecular Formula C32H34ClN7O3
Molecular Weight 600.11 g/mol
SMILES Clc1ccc2c(c1)[nH]c(=O)n2C1CCN(CC1)CCCn1c(=O)n(c2c1cccc2)CCCn1c(=O)[nH]c2c1cccc2
InChIKey RGMCTMMMTSTPET-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is DoMperidoneiMpurityE (CAS: 1346602-50-3) typically synthesized?

DoMperidoneiMpurityE is synthesized through a multi-step process involving the protection and modifi...

Compound Q&A

What industries use DoMperidoneiMpurityE (CAS: 1346602-50-3)?

DoMperidoneiMpurityE is primarily used in the pharmaceutical industry for the development of antipsy...

Compound Q&A

What precautions should be taken when handling DoMperidoneiMpurityE (CAS: 1346602-50-3)?

Handling DoMperidoneiMpurityE requires adherence to strict safety protocols. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...