Compound Q&A

What industries use Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

Answer

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (1:1)
Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) is primarily used in the pharmaceutical industry for its anti-inflammatory and analgesic properties. It also finds applications in the polymer industry as a functional monomer and in the semiconductor industry as a precursor for thin-film deposition processes.

About

English Name Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (1:1)
Molecular Formula C9H13ClN2O2S
Molecular Weight 248.73 g/mol
SMILES CCC=C(C1=CSC(=N1)N)C(=O)OC.Cl
InChIKey ACOBUWCQVBVTGT-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) is a crystalline c...

Compound Q&A

How is Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) typically synthesized?

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride is typically synthesized via a multi-...

Compound Q&A

What precautions should be taken when handling Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

When handling Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5), ens...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...