Compound Q&A

What are the physical and chemical properties of Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

Answer

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (1:1)
Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) is a crystalline compound with a molecular weight of approximately 295.84 g/mol. It has a pKa of about 7.2 and is moderately soluble in water. This compound is reactive towards nucleophiles and can undergo substitution reactions. Its hydrochloride salt form is used in various applications due to its stability and reactivity.

About

English Name Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (1:1)
Molecular Formula C9H13ClN2O2S
Molecular Weight 248.73 g/mol
SMILES CCC=C(C1=CSC(=N1)N)C(=O)OC.Cl
InChIKey ACOBUWCQVBVTGT-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) typically synthesized?

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride is typically synthesized via a multi-...

Compound Q&A

What industries use Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5) is primarily used ...

Compound Q&A

What precautions should be taken when handling Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5)?

When handling Methyl 2-(2-amino-1,3-thiazol-4-yl)-2-pentenoate hydrochloride (CAS: 140128-28-5), ens...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...