Compound Q&A

What precautions should be taken when handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

Answer

4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
When handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol), it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
Molecular Formula C27H24N2O4
Molecular Weight 440.5 g/mol
SMILES COc1cc(ccc1O)/C=C/c2cc(n(n2)c3ccccc3)/C=C/c4ccc(c(c4)OC)O
InChIKey QUOCIDQIFWYHLB-QHKWOANTSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

The compound 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) is a cry...

Compound Q&A

How is 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of 2-...

Compound Q&A

What industries use 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

This compound is used in the pharmaceutical industry for the development of novel drugs, particularl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...