Compound Q&A

How is 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8) typically synthesized?

Answer

4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
This compound is typically synthesized through a multistep reaction involving the condensation of 2-methoxyphenol with 1-phenyl-1H-pyrazole-3,5-dione. The synthesis involves the use of a palladium catalyst and requires careful control of reaction conditions, such as temperature and solvent. The product is isolated by column chromatography, and its purity is confirmed by spectroscopic methods like NMR and mass spectrometry.

About

English Name 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
Molecular Formula C27H24N2O4
Molecular Weight 440.5 g/mol
SMILES COc1cc(ccc1O)/C=C/c2cc(n(n2)c3ccccc3)/C=C/c4ccc(c(c4)OC)O
InChIKey QUOCIDQIFWYHLB-QHKWOANTSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

The compound 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) is a cry...

Compound Q&A

What industries use 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

This compound is used in the pharmaceutical industry for the development of novel drugs, particularl...

Compound Q&A

What precautions should be taken when handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

When handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...