Compound Q&A

What are the physical and chemical properties of 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

Answer

4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
The compound 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) is a crystalline solid with a molecular weight of approximately 487.31 g/mol. It is poorly soluble in water but has good solubility in organic solvents such as ethanol and dichloromethane. Chemically, it is stable under normal conditions but sensitive to strong acids and bases. It exhibits moderate reactivity towards nucleophiles and electrophiles, making it suitable for various chemical transformations.

About

English Name 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
Molecular Formula C27H24N2O4
Molecular Weight 440.5 g/mol
SMILES COc1cc(ccc1O)/C=C/c2cc(n(n2)c3ccccc3)/C=C/c4ccc(c(c4)OC)O
InChIKey QUOCIDQIFWYHLB-QHKWOANTSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of 2-...

Compound Q&A

What industries use 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

This compound is used in the pharmaceutical industry for the development of novel drugs, particularl...

Compound Q&A

What precautions should be taken when handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

When handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...