Compound Q&A

What industries use 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

Answer

4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
This compound is used in the pharmaceutical industry for the development of novel drugs, particularly in the area of anti-inflammatory and anti-cancer treatments. It also finds application in the polymer industry as a precursor for the synthesis of advanced polymers with enhanced thermal and mechanical properties. Additionally, it is explored in the field of semiconductor materials for its potential use in organic electronics and optoelectronics.

About

English Name 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol)
Molecular Formula C27H24N2O4
Molecular Weight 440.5 g/mol
SMILES COc1cc(ccc1O)/C=C/c2cc(n(n2)c3ccccc3)/C=C/c4ccc(c(c4)OC)O
InChIKey QUOCIDQIFWYHLB-QHKWOANTSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

The compound 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) is a cry...

Compound Q&A

How is 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of 2-...

Compound Q&A

What precautions should be taken when handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol) (CAS: 828911-76-8)?

When handling 4,4'-[(1-Phenyl-1H-pyrazole-3,5-diyl)di(E)-2,1-ethenediyl]bis(2-methoxyphenol), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...