Compound Q&A

What industries use (S)-Azelastine HCl (CAS: 153408-27-6)?

Answer

(S)-Azelastine HCl
(S)-Azelastine HCl is primarily used in the pharmaceutical industry for the treatment of allergic rhinitis. It is also utilized in the cosmetics industry as an anti-inflammatory agent. Additionally, it has potential applications in research for studying allergenic and inflammatory responses.

About

English Name (S)-Azelastine HCl
Molecular Formula C22H25Cl2N3O
Molecular Weight 418.37 g/mol
SMILES CN1CCCC(CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl.Cl
InChIKey YEJAJYAHJQIWNU-FERBBOLQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Azelastine HCl (CAS: 153408-27-6)?

(S)-Azelastine HCl is a white to off-white crystalline powder with a molecular weight of approximate...

Compound Q&A

How is (S)-Azelastine HCl (CAS: 153408-27-6) typically synthesized?

(S)-Azelastine HCl is typically synthesized via a multistep process involving the synthesis of azela...

Compound Q&A

What precautions should be taken when handling (S)-Azelastine HCl (CAS: 153408-27-6)?

When handling (S)-Azelastine HCl, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...