Compound Q&A

How is (S)-Azelastine HCl (CAS: 153408-27-6) typically synthesized?

Answer

(S)-Azelastine HCl
(S)-Azelastine HCl is typically synthesized via a multistep process involving the synthesis of azelastine followed by hydrochloric acid addition. Common methods include asymmetric synthesis using chiral auxiliaries or biocatalysis, with high selectivity and yield. Key steps include protection of the amine, asymmetric induction, and deprotection to yield the desired azelastine, which is then converted to its HCl salt.

About

English Name (S)-Azelastine HCl
Molecular Formula C22H25Cl2N3O
Molecular Weight 418.37 g/mol
SMILES CN1CCCC(CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl.Cl
InChIKey YEJAJYAHJQIWNU-FERBBOLQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Azelastine HCl (CAS: 153408-27-6)?

(S)-Azelastine HCl is a white to off-white crystalline powder with a molecular weight of approximate...

Compound Q&A

What industries use (S)-Azelastine HCl (CAS: 153408-27-6)?

(S)-Azelastine HCl is primarily used in the pharmaceutical industry for the treatment of allergic rh...

Compound Q&A

What precautions should be taken when handling (S)-Azelastine HCl (CAS: 153408-27-6)?

When handling (S)-Azelastine HCl, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...