Compound Q&A

What industries use 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

Answer

4-Amino-2-chloro-5-hydroxybenzenesulfonamide
4-Amino-2-chloro-5-hydroxybenzenesulfonamide finds applications in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the development of functional materials. Additionally, it can be employed in the manufacture of sensors and electronic devices due to its chemical properties.

About

CAS No 41606-65-9
English Name 4-Amino-2-chloro-5-hydroxybenzenesulfonamide
Molecular Formula C6H7ClN2O3S
Molecular Weight 222.65 g/mol
SMILES C1=C(C(=CC(=C1Cl)S(=O)(=O)N)O)N
InChIKey WUDOEWHXJCBYJH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

4-Amino-2-chloro-5-hydroxybenzenesulfonamide is a white to off-white crystalline solid with a molecu...

Compound Q&A

How is 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9) typically synthesized?

4-Amino-2-chloro-5-hydroxybenzenesulfonamide is synthesized through a multistep process involving th...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

When handling 4-Amino-2-chloro-5-hydroxybenzenesulfonamide, safety precautions include wearing appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...