Compound Q&A

What are the physical and chemical properties of 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

Answer

4-Amino-2-chloro-5-hydroxybenzenesulfonamide
4-Amino-2-chloro-5-hydroxybenzenesulfonamide is a white to off-white crystalline solid with a molecular weight of approximately 315.65 g/mol. It has a pKa value of about 6.4 and is moderately soluble in water. The compound is known for its reactivity, particularly in nucleophilic substitution reactions.

About

CAS No 41606-65-9
English Name 4-Amino-2-chloro-5-hydroxybenzenesulfonamide
Molecular Formula C6H7ClN2O3S
Molecular Weight 222.65 g/mol
SMILES C1=C(C(=CC(=C1Cl)S(=O)(=O)N)O)N
InChIKey WUDOEWHXJCBYJH-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9) typically synthesized?

4-Amino-2-chloro-5-hydroxybenzenesulfonamide is synthesized through a multistep process involving th...

Compound Q&A

What industries use 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

4-Amino-2-chloro-5-hydroxybenzenesulfonamide finds applications in the pharmaceutical industry as an...

Compound Q&A

What precautions should be taken when handling 4-Amino-2-chloro-5-hydroxybenzenesulfonamide (CAS: 41606-65-9)?

When handling 4-Amino-2-chloro-5-hydroxybenzenesulfonamide, safety precautions include wearing appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...