Compound Q&A

What industries use 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

Answer

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid finds applications in the pharmaceutical industry, particularly in the development of anti-inflammatory and antiviral drugs. It is also used in the production of certain polymers and sensors due to its unique structural properties. The compound's ability to form stable complexes with metal ions makes it valuable in semiconductor applications.

About

English Name 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
Molecular Formula C9H12N2O3
Molecular Weight 196.21 g/mol
SMILES CC(C)CC1=CC(=NC(=O)N1)C(=O)O
InChIKey WDIFSCKLWBVBLR-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid is a crystalline solid with a molecular wei...

Compound Q&A

How is 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2) typically synthesized?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid can be synthesized via the condensation of ...

Compound Q&A

What precautions should be taken when handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

When handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...