Compound Q&A

How is 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2) typically synthesized?

Answer

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid can be synthesized via the condensation of isobutyraldehyde and 2-chloro-4-pyrimidinone, followed by amidation. The reaction is typically carried out in the presence of a base such as potassium carbonate, yielding a product with high selectivity and good yield. The method involves careful temperature control to optimize reaction efficiency.

About

English Name 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
Molecular Formula C9H12N2O3
Molecular Weight 196.21 g/mol
SMILES CC(C)CC1=CC(=NC(=O)N1)C(=O)O
InChIKey WDIFSCKLWBVBLR-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

When handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...