Compound Q&A

What are the physical and chemical properties of 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

Answer

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid is a crystalline solid with a molecular weight of approximately 241.22 g/mol. It has a low solubility in water but is more soluble in solvents like DMSO and acetonitrile. It is moderately reactive towards nucleophiles and can undergo esterification and amidation reactions. The compound is stable under normal conditions but should be stored in a dry, cool place away from direct sunlight to prevent degradation.

About

English Name 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid
Molecular Formula C9H12N2O3
Molecular Weight 196.21 g/mol
SMILES CC(C)CC1=CC(=NC(=O)N1)C(=O)O
InChIKey WDIFSCKLWBVBLR-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

How is 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2) typically synthesized?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid can be synthesized via the condensation of ...

Compound Q&A

What industries use 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid (CAS: 876715-59-2)?

When handling 6-Isobutyl-2-oxo-1,2-dihydro-4-pyrimidinecarboxylic acid, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...