Compound Q&A

How is 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0) typically synthesized?

Answer

4-(1-Piperazinyl)-1H-indole dihydrochloride
4-(1-Piperazinyl)-1H-indole dihydrochloride is typically synthesized by the reaction of 4-hydroxyindole with piperazine in the presence of an acid catalyst such as hydrochloric acid. The reaction is carried out at room temperature, and the product is isolated by recrystallization from an appropriate solvent. The yield is moderate, and the purity is high.

About

English Name 4-(1-Piperazinyl)-1H-indole dihydrochloride
Molecular Formula C12H17Cl2N3
Molecular Weight 274.2 g/mol
SMILES C1CN(CCN1)C2=CC=CC3=C2C=CN3.Cl.Cl
InChIKey FHRAUNYCUBSDMF-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

4-(1-Piperazinyl)-1H-indole dihydrochloride is a crystalline white powder with a molecular weight of...

Compound Q&A

What industries use 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

4-(1-Piperazinyl)-1H-indole dihydrochloride is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

When handling 4-(1-Piperazinyl)-1H-indole dihydrochloride, it is important to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...