Compound Q&A

What are the physical and chemical properties of 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

Answer

4-(1-Piperazinyl)-1H-indole dihydrochloride
4-(1-Piperazinyl)-1H-indole dihydrochloride is a crystalline white powder with a molecular weight of approximately 355.75 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dichloromethane. It is slightly basic due to the presence of the chloride salt. This compound is thermally stable but may react with strong bases or oxidizing agents.

About

English Name 4-(1-Piperazinyl)-1H-indole dihydrochloride
Molecular Formula C12H17Cl2N3
Molecular Weight 274.2 g/mol
SMILES C1CN(CCN1)C2=CC=CC3=C2C=CN3.Cl.Cl
InChIKey FHRAUNYCUBSDMF-UHFFFAOYSA-N
Last Updated: 2026-03-08 04:51

Related Q&A

Compound Q&A

How is 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0) typically synthesized?

4-(1-Piperazinyl)-1H-indole dihydrochloride is typically synthesized by the reaction of 4-hydroxyind...

Compound Q&A

What industries use 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

4-(1-Piperazinyl)-1H-indole dihydrochloride is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling 4-(1-Piperazinyl)-1H-indole dihydrochloride (CAS: 255714-24-0)?

When handling 4-(1-Piperazinyl)-1H-indole dihydrochloride, it is important to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...