Compound Q&A

What are the physical and chemical properties of Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5)?

Answer

Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate
Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5) is a crystalline compound with a molecular weight of around 342.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and acetone. It is moderately reactive and can undergo nucleophilic substitution reactions. The compound is stable under normal conditions but should be stored in a dry, cool place.

About

English Name Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate
Molecular Formula C13H15BrO4S
Molecular Weight 347.23 g/mol
SMILES CCOC(=O)C(=CC1=C(C=CS1)CBr)C(=O)OCC
InChIKey ADBJZPBDGYLFRT-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5) typically synthesized?

Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate can be synthesized through a multi-step proce...

Compound Q&A

What industries use Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5)?

Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5) is used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5)?

When handling Diethyl {[3-(bromomethyl)-2-thienyl]methylene}malonate (CAS: 104085-30-5), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...