Compound Q&A

What precautions should be taken when handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

Answer

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
When handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, appropriate personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a lab coat. The material should be handled in a well-ventilated area or a fume hood to avoid inhalation. Spills should be neutralized with an appropriate base and then cleaned up with caution. Always refer to the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 92028-57-4
English Name 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C
InChIKey ZLYUUANOICYAAL-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4) typically synthesized?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is typically synthesized via the reaction of 2,5-dimethy...

Compound Q&A

What industries use 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is used in various industries, particularly in pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...