Compound Q&A

How is 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4) typically synthesized?

Answer

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is typically synthesized via the reaction of 2,5-dimethylpyrrole with benzoic anhydride. This process involves the condensation of pyrrole with the carboxylic acid anhydride followed by hydrolysis to obtain the final product. The reaction is usually carried out under mild conditions with good yield and selectivity.

About

CAS No 92028-57-4
English Name 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C
InChIKey ZLYUUANOICYAAL-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is used in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

When handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...