Compound Q&A

What industries use 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

Answer

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is used in various industries, particularly in pharmaceuticals where it serves as a precursor for drug synthesis. It is also utilized in the polymer industry for modifying polymer properties and in the sensor industry for its reactivity with certain analytes. Additionally, it finds applications in the semiconductor industry as a component in thin-film processes.

About

CAS No 92028-57-4
English Name 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C
InChIKey ZLYUUANOICYAAL-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4) typically synthesized?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is typically synthesized via the reaction of 2,5-dimethy...

Compound Q&A

What precautions should be taken when handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

When handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...