Compound Q&A

What are the physical and chemical properties of 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

Answer

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is a crystalline solid with a molecular weight of approximately 243.27 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is a weak acid and reacts with bases to form salts. It is stable under normal conditions but can decompose at high temperatures.

About

CAS No 92028-57-4
English Name 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid
Molecular Formula C13H13NO2
Molecular Weight 215.25 g/mol
SMILES CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C
InChIKey ZLYUUANOICYAAL-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4) typically synthesized?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is typically synthesized via the reaction of 2,5-dimethy...

Compound Q&A

What industries use 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid is used in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS: 92028-57-4)?

When handling 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...