Compound Q&A

What industries use Clarithromycin F (CAS: 124412-58-4)?

Answer

Clarithromycin F
Clarithromycin F is primarily used in the pharmaceutical industry for developing antibiotics. It is also utilized in research applications, particularly in studies related to antimicrobial activity and molecular biology. Additionally, it has potential applications in the food industry as a preservative and in the agricultural sector for controlling bacterial infections in livestock.

About

English Name Clarithromycin F
Molecular Formula C38H69NO14
Molecular Weight 764 g/mol
SMILES CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)CO)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)OC)C)C)O)(C)O
InChIKey JDKPAXGOJMGSAE-OKRVCPMNSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Clarithromycin F (CAS: 124412-58-4)?

Clarithromycin F is a semi-synthetic macrolide antibiotic with a molecular weight of approximately 8...

Compound Q&A

How is Clarithromycin F (CAS: 124412-58-4) typically synthesized?

Clarithromycin F is typically synthesized through a series of chemical reactions, including condensa...

Compound Q&A

What precautions should be taken when handling Clarithromycin F (CAS: 124412-58-4)?

When handling Clarithromycin F, it is essential to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...