Compound Q&A

How is Clarithromycin F (CAS: 124412-58-4) typically synthesized?

Answer

Clarithromycin F
Clarithromycin F is typically synthesized through a series of chemical reactions, including condensation, reduction, and cyclization steps. The synthesis often involves using tetracyclines as a starting material and employing specific catalysts and solvents to ensure high selectivity and yield. The process requires precise control of reaction conditions to achieve the desired product.

About

English Name Clarithromycin F
Molecular Formula C38H69NO14
Molecular Weight 764 g/mol
SMILES CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)CO)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)OC)C)C)O)(C)O
InChIKey JDKPAXGOJMGSAE-OKRVCPMNSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Clarithromycin F (CAS: 124412-58-4)?

Clarithromycin F is a semi-synthetic macrolide antibiotic with a molecular weight of approximately 8...

Compound Q&A

What industries use Clarithromycin F (CAS: 124412-58-4)?

Clarithromycin F is primarily used in the pharmaceutical industry for developing antibiotics. It is ...

Compound Q&A

What precautions should be taken when handling Clarithromycin F (CAS: 124412-58-4)?

When handling Clarithromycin F, it is essential to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...