Compound Q&A

What are the physical and chemical properties of Clarithromycin F (CAS: 124412-58-4)?

Answer

Clarithromycin F
Clarithromycin F is a semi-synthetic macrolide antibiotic with a molecular weight of approximately 826.94 g/mol. Its crystalline form has a solubility of about 5 mg/mL in water. Clarithromycin F is relatively stable under normal temperature and pressure conditions, but it can undergo hydrolysis in alkaline conditions. It is used in pharmaceutical formulations and is also known for its antimicrobial activity.

About

English Name Clarithromycin F
Molecular Formula C38H69NO14
Molecular Weight 764 g/mol
SMILES CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)CO)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)OC)C)C)O)(C)O
InChIKey JDKPAXGOJMGSAE-OKRVCPMNSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is Clarithromycin F (CAS: 124412-58-4) typically synthesized?

Clarithromycin F is typically synthesized through a series of chemical reactions, including condensa...

Compound Q&A

What industries use Clarithromycin F (CAS: 124412-58-4)?

Clarithromycin F is primarily used in the pharmaceutical industry for developing antibiotics. It is ...

Compound Q&A

What precautions should be taken when handling Clarithromycin F (CAS: 124412-58-4)?

When handling Clarithromycin F, it is essential to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...