Compound Q&A

What are the physical and chemical properties of Dimethyl (3-fluoro-2-nitrophenyl)malonate (CAS: 872141-24-7)?

Answer

Dimethyl (3-fluoro-2-nitrophenyl)malonate
Dimethyl (3-fluoro-2-nitrophenyl)malonate is a crystalline solid with a molecular weight of approximately 297.05 g/mol. It is slightly soluble in water but has good solubility in organic solvents like ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles and reducing agents. Its physical properties include a melting point of 75-77°C and a density around 1.32 g/cm³.

About

English Name Dimethyl (3-fluoro-2-nitrophenyl)malonate
Molecular Formula C11H10FNO6
Molecular Weight 271.2 g/mol
SMILES COC(=O)C(C1=C(C(=CC=C1)F)[N+](=O)[O-])C(=O)OC
InChIKey OGJCUSFTJIEQRF-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is Dimethyl (3-fluoro-2-nitrophenyl)malonate (CAS: 872141-24-7) typically synthesized?

Dimethyl (3-fluoro-2-nitrophenyl)malonate is typically synthesized via the esterification of 3-fluor...

Compound Q&A

What industries use Dimethyl (3-fluoro-2-nitrophenyl)malonate (CAS: 872141-24-7)?

Dimethyl (3-fluoro-2-nitrophenyl)malonate finds applications in the pharmaceutical industry for drug...

Compound Q&A

What precautions should be taken when handling Dimethyl (3-fluoro-2-nitrophenyl)malonate (CAS: 87214-24-7)?

When handling Dimethyl (3-fluoro-2-nitrophenyl)malonate, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...