Compound Q&A

What precautions should be taken when handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

Answer

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
When handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Perform reactions in a well-ventilated fume hood to minimize inhalation risks. Store it in a cool, dry place, away from moisture and heat. In case of a spill, immediately clean up using appropriate absorbents and follow safety data sheet (SDS) guidelines for proper disposal and handling.

About

English Name (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
Molecular Formula C9H12O
Molecular Weight 136.19 g/mol
SMILES C(C)C=1C[C@@H]2CC([C@@H]2C1)=O
InChIKey QEGONAXSXKFDLY-HTQZYQBOSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one crystallizes in a white solid form. Its molecular weigh...

Compound Q&A

How is (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4) typically synthesized?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one is commonly synthesized via a Wittig reaction between e...

Compound Q&A

What industries use (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one finds applications in the pharmaceutical industry for t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...