Compound Q&A

What industries use (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

Answer

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one finds applications in the pharmaceutical industry for the synthesis of bioactive compounds, in the polymer industry for functional polymers, and in the chemical sector for the development of sensors and semiconductors. Its unique structural features make it a valuable intermediate in these industries.

About

English Name (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
Molecular Formula C9H12O
Molecular Weight 136.19 g/mol
SMILES C(C)C=1C[C@@H]2CC([C@@H]2C1)=O
InChIKey QEGONAXSXKFDLY-HTQZYQBOSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one crystallizes in a white solid form. Its molecular weigh...

Compound Q&A

How is (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4) typically synthesized?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one is commonly synthesized via a Wittig reaction between e...

Compound Q&A

What precautions should be taken when handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

When handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...