Compound Q&A

What are the physical and chemical properties of (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

Answer

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one crystallizes in a white solid form. Its molecular weight is approximately 154.24 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Reactivity-wise, it shows electrophilic aromatic substitution properties and can undergo hydrolysis under basic conditions. It is stable under normal laboratory conditions but should be stored away from moisture and heat.

About

English Name (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one
Molecular Formula C9H12O
Molecular Weight 136.19 g/mol
SMILES C(C)C=1C[C@@H]2CC([C@@H]2C1)=O
InChIKey QEGONAXSXKFDLY-HTQZYQBOSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4) typically synthesized?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one is commonly synthesized via a Wittig reaction between e...

Compound Q&A

What industries use (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

(1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one (CAS: 1235479-61-4)?

When handling (1R,5S)-3-Ethylbicyclo[3.2.0]hept-3-en-6-one, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...