Compound Q&A

What precautions should be taken when handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

Answer

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
When handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to minimize exposure to fumes. Spills should be cleaned up carefully, and the material safety data sheet (MSDS) should be consulted for specific spill procedures. Proper storage in a cool, dry place away from moisture and light is recommended to prevent degradation.

About

English Name 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CN=C(C(=C1C(F)(F)F)Cl)C(=O)O
InChIKey WDORPWNWWOLVPN-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is a white to off-white crystalline solid wit...

Compound Q&A

How is 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2) typically synthesized?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the reaction of ...

Compound Q&A

What industries use 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid finds applications in pharmaceuticals, where ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...