Compound Q&A

What are the physical and chemical properties of 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

Answer

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 236.01 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is known for its high reactivity, particularly towards nucleophiles and bases. It is also stable under normal storage conditions but can degrade upon exposure to moisture and light.

About

English Name 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CN=C(C(=C1C(F)(F)F)Cl)C(=O)O
InChIKey WDORPWNWWOLVPN-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2) typically synthesized?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the reaction of ...

Compound Q&A

What industries use 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid finds applications in pharmaceuticals, where ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

When handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...