Compound Q&A

How is 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2) typically synthesized?

Answer

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the reaction of 4-chloro-2-pyridinecarboxylic acid with trifluoromethanesulfonyl chloride in the presence of a base such as triethylamine. The reaction yields a high purity product with a yield of around 85%. The use of appropriate catalysts and solvents is crucial to achieve the desired product with good selectivity.

About

English Name 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CN=C(C(=C1C(F)(F)F)Cl)C(=O)O
InChIKey WDORPWNWWOLVPN-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is a white to off-white crystalline solid wit...

Compound Q&A

What industries use 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid finds applications in pharmaceuticals, where ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

When handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...