Compound Q&A

What industries use 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

Answer

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid finds applications in pharmaceuticals, where it serves as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the development of special polymers and in the semiconductor industry for the production of sensitive electronic components. Additionally, it is utilized in the synthesis of certain sensors and as a reagent in analytical chemistry.

About

English Name 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CN=C(C(=C1C(F)(F)F)Cl)C(=O)O
InChIKey WDORPWNWWOLVPN-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is a white to off-white crystalline solid wit...

Compound Q&A

How is 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2) typically synthesized?

3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the reaction of ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 796090-27-2)?

When handling 3-Chloro-4-(trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...