Compound Q&A

What industries use Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Answer

Methyl 6-nitro-2-indolinecarboxylate
Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the preparation of materials for sensors and in some semiconductor applications due to its specific chemical properties.

About

English Name Methyl 6-nitro-2-indolinecarboxylate
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES COC(=O)C1CC2=C(N1)C=C(C=C2)[N+](=O)[O-]
InChIKey PEFQAKIOILEYAZ-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is a white crystalline solid with a molecula...

Compound Q&A

How is Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) typically synthesized?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) can be synthesized by the nitration of 2-ind...

Compound Q&A

What precautions should be taken when handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

When handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...