Compound Q&A

What are the physical and chemical properties of Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Answer

Methyl 6-nitro-2-indolinecarboxylate
Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is a white crystalline solid with a molecular weight of approximately 221.08 g/mol. It is soluble in common organic solvents like ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles. It is stable under neutral and slightly acidic conditions but can undergo hydrolysis under basic conditions.

About

English Name Methyl 6-nitro-2-indolinecarboxylate
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES COC(=O)C1CC2=C(N1)C=C(C=C2)[N+](=O)[O-]
InChIKey PEFQAKIOILEYAZ-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) typically synthesized?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) can be synthesized by the nitration of 2-ind...

Compound Q&A

What industries use Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

When handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...