Compound Q&A

How is Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) typically synthesized?

Answer

Methyl 6-nitro-2-indolinecarboxylate
Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) can be synthesized by the nitration of 2-indolinecarboxylic acid with concentrated nitric acid in the presence of a catalyst like sulfuric acid. The reaction is typically carried out at room temperature, and the product is purified by recrystallization from ethanol. The yield is generally around 80-85%.

About

English Name Methyl 6-nitro-2-indolinecarboxylate
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES COC(=O)C1CC2=C(N1)C=C(C=C2)[N+](=O)[O-]
InChIKey PEFQAKIOILEYAZ-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is a white crystalline solid with a molecula...

Compound Q&A

What industries use Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2)?

When handling Methyl 6-nitro-2-indolinecarboxylate (CAS: 428861-43-2), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...