Compound Q&A

What precautions should be taken when handling 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

Answer

2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
When handling this compound, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to cyanide vapor. Spills should be cleaned up carefully, using appropriate absorbent materials and following the safety data sheet (SDS) guidelines. Storage should be at room temperature in a secure, labeled container away from moisture and incompatible substances.

About

CAS No 79026-03-2
English Name 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
Molecular Formula C24H16N2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C=CC3=CC(=CC=C3)C#N)C#N
InChIKey JRVKAPLKKVWGKU-SQIWNDBBSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

The compound has a crystalline form with a molecular weight of approximately 381.13 g/mol. It is sli...

Compound Q&A

How is 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving the formation of an interm...

Compound Q&A

What industries use 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

This compound is used in various industries, including pharmaceuticals, where it serves as a precurs...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...