Compound Q&A

What are the physical and chemical properties of 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

Answer

2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
The compound has a crystalline form with a molecular weight of approximately 381.13 g/mol. It is slightly soluble in common organic solvents such as acetone and chloroform. Reactivity studies indicate it is moderately reactive towards nucleophiles and electrophiles, making it useful in various chemical reactions. It exhibits good thermal stability up to 200°C without decomposition.

About

CAS No 79026-03-2
English Name 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
Molecular Formula C24H16N2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C=CC3=CC(=CC=C3)C#N)C#N
InChIKey JRVKAPLKKVWGKU-SQIWNDBBSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

How is 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving the formation of an interm...

Compound Q&A

What industries use 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

This compound is used in various industries, including pharmaceuticals, where it serves as a precurs...

Compound Q&A

What precautions should be taken when handling 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...