Compound Q&A

What industries use 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

Answer

2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
This compound is used in various industries, including pharmaceuticals, where it serves as a precursor for certain drug molecules. It is also utilized in the production of polymers and sensors due to its unique chemical properties. Additionally, it finds applications in semiconductor manufacturing as it can serve as a dopant or functional group in materials science.

About

CAS No 79026-03-2
English Name 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
Molecular Formula C24H16N2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C=CC3=CC(=CC=C3)C#N)C#N
InChIKey JRVKAPLKKVWGKU-SQIWNDBBSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

The compound has a crystalline form with a molecular weight of approximately 381.13 g/mol. It is sli...

Compound Q&A

How is 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving the formation of an interm...

Compound Q&A

What precautions should be taken when handling 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...