Compound Q&A

How is 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2) typically synthesized?

Answer

2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
This compound is typically synthesized via a multi-step process involving the formation of an intermediate vinyl cyanide followed by coupling with a phenyl vinyl compound. The synthesis involves the use of transition metal catalysts and requires careful control of reaction conditions to achieve high selectivity and yield. The exact method can vary depending on the specific starting materials and desired end product.

About

CAS No 79026-03-2
English Name 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile
Molecular Formula C24H16N2
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C=CC3=CC(=CC=C3)C#N)C#N
InChIKey JRVKAPLKKVWGKU-SQIWNDBBSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

The compound has a crystalline form with a molecular weight of approximately 381.13 g/mol. It is sli...

Compound Q&A

What industries use 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

This compound is used in various industries, including pharmaceuticals, where it serves as a precurs...

Compound Q&A

What precautions should be taken when handling 2-[(E)-2-{4-[(E)-2-(3-Cyanophenyl)vinyl]phenyl}vinyl]benzonitrile (CAS: 79026-03-2)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...