Compound Q&A

What industries use (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

Answer

(5-Amino-2-nitrophenyl)methanol
(5-Amino-2-nitrophenyl)methanol is primarily used in the pharmaceutical and dye industries. It serves as a key intermediate in the synthesis of various pharmaceutical compounds and also finds applications in the production of organic dyes due to its structural similarity to aromatic compounds.

About

CAS No 77376-03-5
English Name (5-Amino-2-nitrophenyl)methanol
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES C1=CC(=C(C=C1N)CO)[N+](=O)[O-]
InChIKey VHFDIPNKJJLFLN-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

(5-Amino-2-nitrophenyl)methanol is a crystalline solid with a molecular weight of approximately 210....

Compound Q&A

How is (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5) typically synthesized?

(5-Amino-2-nitrophenyl)methanol can be synthesized by the nitration of (5-aminophenyl)methanol follo...

Compound Q&A

What precautions should be taken when handling (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

Precautions for handling (5-Amino-2-nitrophenyl)methanol include wearing appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...