Compound Q&A

What are the physical and chemical properties of (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

Answer

(5-Amino-2-nitrophenyl)methanol
(5-Amino-2-nitrophenyl)methanol is a crystalline solid with a molecular weight of approximately 210.07 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetonitrile. Chemically, it is relatively stable but can react with acids and bases. It is used as an intermediate in the synthesis of dyes and pharmaceuticals.

About

CAS No 77376-03-5
English Name (5-Amino-2-nitrophenyl)methanol
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES C1=CC(=C(C=C1N)CO)[N+](=O)[O-]
InChIKey VHFDIPNKJJLFLN-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

How is (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5) typically synthesized?

(5-Amino-2-nitrophenyl)methanol can be synthesized by the nitration of (5-aminophenyl)methanol follo...

Compound Q&A

What industries use (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

(5-Amino-2-nitrophenyl)methanol is primarily used in the pharmaceutical and dye industries. It serve...

Compound Q&A

What precautions should be taken when handling (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

Precautions for handling (5-Amino-2-nitrophenyl)methanol include wearing appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...