Compound Q&A

How is (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5) typically synthesized?

Answer

(5-Amino-2-nitrophenyl)methanol
(5-Amino-2-nitrophenyl)methanol can be synthesized by the nitration of (5-aminophenyl)methanol followed by alcoholysis. Commonly, this involves treating (5-aminophenyl)methanol with nitric acid and sulfuric acid to form the nitro compound, which is then reduced to the alcohol using a reducing agent like sodium borohydride. The overall yield is moderate, and careful control of reaction conditions is necessary.

About

CAS No 77376-03-5
English Name (5-Amino-2-nitrophenyl)methanol
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES C1=CC(=C(C=C1N)CO)[N+](=O)[O-]
InChIKey VHFDIPNKJJLFLN-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

(5-Amino-2-nitrophenyl)methanol is a crystalline solid with a molecular weight of approximately 210....

Compound Q&A

What industries use (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

(5-Amino-2-nitrophenyl)methanol is primarily used in the pharmaceutical and dye industries. It serve...

Compound Q&A

What precautions should be taken when handling (5-Amino-2-nitrophenyl)methanol (CAS: 77376-03-5)?

Precautions for handling (5-Amino-2-nitrophenyl)methanol include wearing appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...