Compound Q&A

What precautions should be taken when handling 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

Answer

8-(Tributylstannyl)quinoline
When handling 8-(Tributylstannyl)quinoline, it is crucial to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated fume hood to avoid inhalation. Spills should be cleaned up carefully using absorbent materials and disposed of according to local regulations. It is essential to consult the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name 8-(Tributylstannyl)quinoline
Molecular Formula C21H33NSn
Molecular Weight 418.21 g/mol
SMILES CCCC[Sn](CCCC)(CCCC)C1=CC=CC2=C1N=CC=C2
InChIKey CFXBLYUOIPJSEG-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

8-(Tributylstannyl)quinoline is a yellow solid with a crystalline form. Its molecular weight is appr...

Compound Q&A

How is 8-(Tributylstannyl)quinoline (CAS: 478282-21-2) typically synthesized?

8-(Tributylstannyl)quinoline is typically synthesized via the Grignard reaction, where a quinoline r...

Compound Q&A

What industries use 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

8-(Tributylstannyl)quinoline is used in various industries, particularly in the pharmaceutical and s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...