Compound Q&A

What are the physical and chemical properties of 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

Answer

8-(Tributylstannyl)quinoline
8-(Tributylstannyl)quinoline is a yellow solid with a crystalline form. Its molecular weight is approximately 519.4 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and dichloromethane. Chemically, it is relatively stable but can react with acids, leading to the formation of stannic salts. It is typically stored in a dry, dark place to prevent degradation.

About

English Name 8-(Tributylstannyl)quinoline
Molecular Formula C21H33NSn
Molecular Weight 418.21 g/mol
SMILES CCCC[Sn](CCCC)(CCCC)C1=CC=CC2=C1N=CC=C2
InChIKey CFXBLYUOIPJSEG-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

How is 8-(Tributylstannyl)quinoline (CAS: 478282-21-2) typically synthesized?

8-(Tributylstannyl)quinoline is typically synthesized via the Grignard reaction, where a quinoline r...

Compound Q&A

What industries use 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

8-(Tributylstannyl)quinoline is used in various industries, particularly in the pharmaceutical and s...

Compound Q&A

What precautions should be taken when handling 8-(Tributylstannyl)quinoline (CAS: 478282-21-2)?

When handling 8-(Tributylstannyl)quinoline, it is crucial to use appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...