Compound Q&A

What industries use Akt1 and Akt2-IN-1 (CAS: 893422-47-4)?

Answer

Akt1 and Akt2-IN-1
Akt1 and Akt2-IN-1 (CAS: 893422-47-4) is primarily used in the pharmaceutical industry for research on Akt1 and Akt2 kinases. It is also of interest in the development of potential therapeutic agents for diseases such as cancer and diabetes. The compound has applications in research related to signal transduction pathways and cellular responses.

About

English Name Akt1 and Akt2-IN-1
Molecular Formula C33H29N7O
Molecular Weight 539.64 g/mol
SMILES C1CN(CCC1C2=NC(=NN2)C3=CC=CC=N3)CC4=CC=C(C=C4)C5=C(C=C6C(=N5)C=CNC6=O)C7=CC=CC=C7
InChIKey BTUWHHFNOHVCMQ-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Akt1 and Akt2-IN-1 (CAS: 893422-47-4)?

Akt1 and Akt2-IN-1 (CAS: 893422-47-4) is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is Akt1 and Akt2-IN-1 (CAS: 893422-47-4) typically synthesized?

Akt1 and Akt2-IN-1 (CAS: 893422-47-4) is typically synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling Akt1 and Akt2-IN-1 (CAS: 893422-47-4)?

When handling Akt1 and Akt2-IN-1 (CAS: 893422-47-4), it is important to follow standard laboratory s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...