Compound Q&A

What precautions should be taken when handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

Answer

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone
When handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to air. In case of a spill, the area should be immediately flushed with water, and the spill should be cleaned up using appropriate absorbent materials. It is crucial to refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name (4-Chlorophenyl)(1-fluorocyclopropyl)methanone
Molecular Formula C10H8ClFO
Molecular Weight 198.62 g/mol
SMILES C1CC1(C(=O)C2=CC=C(C=C2)Cl)F
InChIKey JNAIPRZVBAOLMT-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is a white to light yellow crystalline solid with a m...

Compound Q&A

How is (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8) typically synthesized?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is typically synthesized via a Wittig reaction involv...

Compound Q&A

What industries use (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is used in the pharmaceutical industry for the synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...