Compound Q&A

What are the physical and chemical properties of (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

Answer

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone
(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is a white to light yellow crystalline solid with a molecular weight of approximately 244.02 g/mol. Its solubility in water is low, with a maximum solubility of about 0.5 g/100 mL at 25°C. It is highly reactive due to the presence of a ketone group and a chlorine atom. The compound is stable under normal conditions but requires storage in a cool, dark place to prevent decomposition.

About

English Name (4-Chlorophenyl)(1-fluorocyclopropyl)methanone
Molecular Formula C10H8ClFO
Molecular Weight 198.62 g/mol
SMILES C1CC1(C(=O)C2=CC=C(C=C2)Cl)F
InChIKey JNAIPRZVBAOLMT-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

How is (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8) typically synthesized?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is typically synthesized via a Wittig reaction involv...

Compound Q&A

What industries use (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

When handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...