Compound Q&A

What industries use (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

Answer

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone
(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is used in the pharmaceutical industry for the synthesis of certain drugs due to its unique functional groups. It is also used in the semiconductor industry for the production of photoresists and other materials. Additionally, it has potential applications in the field of polymer chemistry, where its reactivity can be utilized in the development of new materials.

About

English Name (4-Chlorophenyl)(1-fluorocyclopropyl)methanone
Molecular Formula C10H8ClFO
Molecular Weight 198.62 g/mol
SMILES C1CC1(C(=O)C2=CC=C(C=C2)Cl)F
InChIKey JNAIPRZVBAOLMT-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is a white to light yellow crystalline solid with a m...

Compound Q&A

How is (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8) typically synthesized?

(4-Chlorophenyl)(1-fluorocyclopropyl)methanone is typically synthesized via a Wittig reaction involv...

Compound Q&A

What precautions should be taken when handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone (CAS: 103543-60-8)?

When handling (4-Chlorophenyl)(1-fluorocyclopropyl)methanone, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...