Compound Q&A

What precautions should be taken when handling Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

Answer

Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to prevent inhalation. Spills should be promptly cleaned up with appropriate absorbents, and the SDS (Safety Data Sheet) should be consulted for detailed instructions. Ensure proper storage in a dry, cool place, away from incompatible materials.

About

English Name Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
Molecular Formula C20H24O5S
Molecular Weight 376.47 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=C(C=C2)C(C)(C)C(=O)OC
InChIKey ILCKTEFFKTZBLQ-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

The compound is a crystalline solid with a molecular weight of approximately 414.47 g/mol. It has li...

Compound Q&A

How is Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0) typically synthesized?

The compound is typically synthesized through a multi-step process involving the coupling of a sulfo...

Compound Q&A

What industries use Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a precursor in t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...