Compound Q&A

What industries use Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

Answer

Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
This compound is primarily used in the pharmaceutical industry for its potential as a precursor in the synthesis of various drugs. It also has applications in the chemical industry, particularly in the development of functional materials such as sensors and semiconductors.

About

English Name Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate
Molecular Formula C20H24O5S
Molecular Weight 376.47 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=C(C=C2)C(C)(C)C(=O)OC
InChIKey ILCKTEFFKTZBLQ-UHFFFAOYSA-N
Last Updated: 2026-03-01 18:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

The compound is a crystalline solid with a molecular weight of approximately 414.47 g/mol. It has li...

Compound Q&A

How is Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0) typically synthesized?

The compound is typically synthesized through a multi-step process involving the coupling of a sulfo...

Compound Q&A

What precautions should be taken when handling Methyl 2-methyl-2-[4-(2-{[(4-methylphenyl)sulfonyl]oxy}ethyl)phenyl]propanoate (CAS: 1181267-30-0)?

When handling this compound, it is crucial to use personal protective equipment (PPE) such as gloves...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...